IB Chemistry SL Topic 4 — Energy Cycles Paper 1 & 2 Core skill ~12 min read

Bond Enthalpy Calculations

Strip a reaction down and it is only two things happening: old bonds coming apart and new ones snapping together. Pulling atoms apart costs energy, letting them join releases it — and the gap between those two amounts is the enthalpy change.

📚 What you need to know

Breaking costs, making pays

A covalent bond is an attraction between two nuclei and a shared pair of electrons. To separate the atoms you have to pull against that attraction, and pulling against an attraction always takes energy. So bond breaking is endothermic.

Run it backwards and the logic reverses. Two atoms falling together into a bond release energy, exactly as a ball releases energy falling towards the ground. So bond making is exothermic.

Bond enthalpy the energy required to break one mole of a bond, in the gaseous state

Because breaking and making are the same event in opposite directions, they involve the same amount of energy with the opposite sign. Breaking one mole of H–Cl bonds takes in 431 kJ; forming one mole gives out 431 kJ. That symmetry is what makes the whole calculation work.

Data booklet values are all positive, because they are quoted for breaking. You are the one who has to decide where the minus signs go — the booklet will not do it for you.

Where the formula comes from

Imagine taking the reaction by a deliberately silly route. First rip every reactant molecule apart into separate gaseous atoms. Then let those atoms rebuild themselves as the products. You end up in exactly the same place, so the energy change must be the same.

WHY THE FORMULA WORKStake the molecules apart into atoms, then rebuild themENTHALPYREACTANTSSEPARATED GASEOUS ATOMSPRODUCTSenergy INbreaking every bondendothermic, +energy OUTmaking every bondexothermic, −ΔHΔH = energy put in breaking bonds − energy given out making bonds
Up the hill to separated atoms, back down to the products. The difference between the climb and the drop is the enthalpy change.

The climb up costs you every bond in the reactants. The drop down pays you back every bond in the products. Subtract one from the other:

Enthalpy change from bond enthalpies ΔH = Σ(bonds broken) – Σ(bonds formed)

Read the result like a balance sheet. If the products’ bonds give out more than the reactants’ bonds cost, the answer comes out negative and the reaction is exothermic. Stronger bonds in the products means a more stable product mixture and a more negative ΔH.

You may see the same idea written as ΔH = Σ(bonds broken) + Σ(bonds formed), with the “formed” values entered as negatives. Same maths, more chances to lose a minus sign. Pick one version and stick to it.

Why the values are only averages

A C–H bond in methane is not quite the same bond as a C–H bond in ethanol, because the rest of the molecule pulls on the electrons differently. Even inside a single methane molecule the four C–H bonds do not break equally easily: once one hydrogen has gone, the remaining ones are held differently.

THE FOUR C–H BONDS ARE NOT IDENTICALenergy to pull off each hydrogen of methane in turn, in kJ mol−¹4401st H4602nd H4253rd H3404th Hdata booklet average = 414no single C–H bond enthalpy exists, so every answer you get is approximate
Four bonds, four different values. The number in the data booklet is the average of these, further averaged across many similar compounds.

So the data booklet cannot give you the C–H bond enthalpy. It gives an average bond enthalpy: the mean energy needed to break one mole of that bond, averaged over a range of similar compounds. That has two consequences you should be ready to state:

If a question gives you an equation with a state symbol of (l) and asks you to comment on your answer, that state symbol is the hint. Bond enthalpies are gas-phase numbers.

Doing the calculation

🧩 The method, every time

  1. Write the balanced equation. For an enthalpy of combustion, scale it so that one mole of the fuel burns, even if that means halves.
  2. Draw the displayed formula of every substance, showing every single bond.
  3. Add up the bonds broken, multiplying each bond enthalpy by how many there are.
  4. Add up the bonds formed the same way.
  5. ΔH = broken – formed. Give the answer in kJ mol–1 with its sign.
DRAW IT OUT, THEN COUNT EVERY BONDCH₄(g) + 2O₂(g) → CO₂(g) + 2H₂O(g)CHHHH+OOOOOCOHOHHOHBONDS BROKEN4 × C–H = 16562 × O=O = 996total = +2652BONDS FORMED2 × C=O = 16084 × O–H = 1852total = 3460the 2 in front of H₂O means FOUR O–H bonds, not two
The coefficients are part of the count. Two water molecules mean four O–H bonds, and it is astonishingly easy to write two.
WORKED EXAMPLE

Use the bond enthalpies H–H = 436, Cl–Cl = 242 and H–Cl = 431 kJ mol–1 to calculate ΔH for H2(g) + Cl2(g) → 2HCl(g).

Step 1 — bonds broken 1 × H–H = 436    1 × Cl–Cl = 242    total = 678 Step 2 — bonds formed 2 × H–Cl = 2 × 431 = 862 Step 3 — subtract 678 − 862 = −184 ΔH = −184 kJ mol⁻¹ The 2 in front of HCl doubles that bond enthalpy. Miss it and you get +247, which is not even the right sign.
WORKED EXAMPLE

Calculate ΔH for the hydrogenation of ethene, C2H4(g) + H2(g) → C2H6(g). Use C–H = 414, C=C = 614, C–C = 346, H–H = 436 kJ mol–1.

Step 1 — bonds broken (ethene + hydrogen) 4 × C–H = 1656    1 × C=C = 614    1 × H–H = 436 total = 2706 Step 2 — bonds formed (ethane) 6 × C–H = 2484    1 × C–C = 346    total = 2830 Step 3 — subtract 2706 − 2830 = −124 ΔH = −124 kJ mol⁻¹ Shortcut worth spotting: the four C–H bonds appear on both sides, so they cancel. Only C=C + H–H against 2 C–H + C–C actually matters.
WORKED EXAMPLE

Calculate the enthalpy of combustion of methane, CH4(g) + 2O2(g) → CO2(g) + 2H2O(g), using C–H = 414, O=O = 498, C=O = 804, O–H = 463 kJ mol–1. Compare it with the accepted value of –891 kJ mol–1.

Step 1 — bonds broken 4 × C–H = 1656    2 × O=O = 996    total = 2652 Step 2 — bonds formed CO₂ has two C=O bonds, and each of the two waters has two O–H bonds. 2 × C=O = 1608    4 × O–H = 1852    total = 3460 Step 3 — subtract 2652 − 3460 = −808 ΔH = −808 kJ mol⁻¹ About 80 kJ less exothermic than the accepted value. Most of that gap is the water: the accepted figure is for liquid water, and condensing 2 mol of steam would release roughly another 88 kJ. The rest is the use of averaged bond enthalpies.

💡 Exam tip

⚠️ Common mix-up

Up next: Hess’s Law — because bond enthalpies are really just one particular route through a reaction, and once you see that, you can build a route through almost anything.

Want this explained one-to-one?

Book a free session with an experienced IB Chemistry tutor and get your trickiest topics made simple.

Book a Free Session →